Description: |
Profenophos is an non-systemic insecticide and acaricide with contact and stomach action. Exhibits a translaminar effect. Has ovicidal properties. Control of insects (particularly Lepidoptera) and mites on cotton, maize, sugar beet, soya beans, potatoes, vegetable, tobacco, and other crops. |
Chemical Name: |
O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate |
CAS Registry No.: |
41198-08-7 |
Structural Formula: |
|
Specification: |
|
Formulations: |
EC or as per Customer's specific requirment |
Compatibility: |
Incompatible with alkaline material |
Toxicity: |
|
Shelf Life: |
Two years under normal storage conditions. |
Packaging: |
|
| |
